C11H18N4O3 — CID 125161861
(2S)-2-amino-N-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]hexanamide (PubChem CID 125161861) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]hexanamide.
| Compound Name | (2S)-2-amino-N-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]hexanamide |
|---|---|
| PubChem CID | 125161861 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (2S)-2-amino-N-[(2,4-dioxo-1H-pyrimidin-5-yl)methyl]hexanamide |
| SMILES | CCCC[C@H](N)C(=O)NCc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H18N4O3/c1-2-3-4-8(12)10(17)13-5-7-6-14-11(18)15-9(7)16/h6,8H,2-5,12H2,1H3,(H,13,17)(H2,14,15,16,18)/t8-/m0/s1 |
| InChIKey | IWAHDDPMNPIKNA-QMMMGPOBSA-N |
| XLogP | -0.80 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |