C16H24N2O4 — CID 125163140
(3S)-3-[(1,5,6-trimethyl-2-oxopyridine-3-carbonyl)amino]heptanoic acid (PubChem CID 125163140) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is (3S)-3-[(1,5,6-trimethyl-2-oxopyridine-3-carbonyl)amino]heptanoic acid.
| Compound Name | (3S)-3-[(1,5,6-trimethyl-2-oxopyridine-3-carbonyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 125163140 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | (3S)-3-[(1,5,6-trimethyl-2-oxopyridine-3-carbonyl)amino]heptanoic acid |
| SMILES | CCCC[C@@H](CC(=O)O)NC(=O)c1cc(C)c(C)n(C)c1=O |
| InChI | InChI=1S/C16H24N2O4/c1-5-6-7-12(9-14(19)20)17-15(21)13-8-10(2)11(3)18(4)16(13)22/h8,12H,5-7,9H2,1-4H3,(H,17,21)(H,19,20)/t12-/m0/s1 |
| InChIKey | SVKBQMCZUBMFAT-LBPRGKRZSA-N |
| XLogP | 1.77 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |