About (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one
(5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one (PubChem CID 125163192) has the molecular formula C23H30N2O
and a molecular weight of 350.51 g/mol. Its IUPAC name is (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one |
| PubChem CID | 125163192 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one |
| SMILES | CCNCC[C@@H]1CCC(=O)N1CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O/c1-2-24-17-15-21-13-14-23(26)25(21)18-16-22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,21-22,24H,2,13-18H2,1H3/t21-/m0/s1 |
| InChIKey | VAAYFTLADCDPOR-NRFANRHFSA-N |
| XLogP | 4.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one?
The IUPAC name of (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one (CID 125163192) is (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one.
What is the SMILES notation for (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one?
The canonical SMILES for (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one is CCNCC[C@@H]1CCC(=O)N1CCC(c1ccccc1)c1ccccc1.
What is the InChIKey of (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one?
The InChIKey is VAAYFTLADCDPOR-NRFANRHFSA-N. The full InChI is InChI=1S/C23H30N2O/c1-2-24-17-15-21-13-14-23(26)25(21)18-16-22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,21-22,24H,2,13-18H2,1H3/t21-/m0/s1.
What are the key properties of (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one?
(5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one has a molecular weight of 350.51 g/mol, XLogP of 4.20, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one is sourced from PubChem (CID 125163192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).