C23H30N2O — CID 125163192
(5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one (PubChem CID 125163192) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one.
| Compound Name | (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 125163192 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (5S)-1-(3,3-diphenylpropyl)-5-[2-(ethylamino)ethyl]pyrrolidin-2-one |
| SMILES | CCNCC[C@@H]1CCC(=O)N1CCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O/c1-2-24-17-15-21-13-14-23(26)25(21)18-16-22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,21-22,24H,2,13-18H2,1H3/t21-/m0/s1 |
| InChIKey | VAAYFTLADCDPOR-NRFANRHFSA-N |
| XLogP | 4.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|