C19H23N3O2S — CID 125163751
1-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(2S)-1-thiophen-2-ylpropan-2-yl]urea (PubChem CID 125163751) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(2S)-1-thiophen-2-ylpropan-2-yl]urea.
| Compound Name | 1-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(2S)-1-thiophen-2-ylpropan-2-yl]urea |
|---|---|
| PubChem CID | 125163751 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-[4-methyl-3-(2-oxopyrrolidin-1-yl)phenyl]-3-[(2S)-1-thiophen-2-ylpropan-2-yl]urea |
| SMILES | Cc1ccc(NC(=O)N[C@@H](C)Cc2cccs2)cc1N1CCCC1=O |
| InChI | InChI=1S/C19H23N3O2S/c1-13-7-8-15(12-17(13)22-9-3-6-18(22)23)21-19(24)20-14(2)11-16-5-4-10-25-16/h4-5,7-8,10,12,14H,3,6,9,11H2,1-2H3,(H2,20,21,24)/t14-/m0/s1 |
| InChIKey | VXRLXUMSGNMYAP-AWEZNQCLSA-N |
| XLogP | 3.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |