C19H23N5O — CID 125164946
2-ethyl-N-[(1S)-2-methyl-1-(6-methyl-1H-benzimidazol-2-yl)propyl]pyrimidine-5-carboxamide (PubChem CID 125164946) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is 2-ethyl-N-[(1S)-2-methyl-1-(6-methyl-1H-benzimidazol-2-yl)propyl]pyrimidine-5-carboxamide.
| Compound Name | 2-ethyl-N-[(1S)-2-methyl-1-(6-methyl-1H-benzimidazol-2-yl)propyl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 125164946 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-ethyl-N-[(1S)-2-methyl-1-(6-methyl-1H-benzimidazol-2-yl)propyl]pyrimidine-5-carboxamide |
| SMILES | CCc1ncc(C(=O)N[C@H](c2nc3ccc(C)cc3[nH]2)C(C)C)cn1 |
| InChI | InChI=1S/C19H23N5O/c1-5-16-20-9-13(10-21-16)19(25)24-17(11(2)3)18-22-14-7-6-12(4)8-15(14)23-18/h6-11,17H,5H2,1-4H3,(H,22,23)(H,24,25)/t17-/m0/s1 |
| InChIKey | GVMNWAFIWUGXHG-KRWDZBQOSA-N |
| XLogP | 3.35 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |