C19H26ClN5O — CID 125164986
1-(8-chloroquinolin-5-yl)-3-[(3R)-3-(4-methylpiperazin-1-yl)butyl]urea (PubChem CID 125164986) has the molecular formula C19H26ClN5O and a molecular weight of 375.90 g/mol. Its IUPAC name is 1-(8-chloroquinolin-5-yl)-3-[(3R)-3-(4-methylpiperazin-1-yl)butyl]urea.
| Compound Name | 1-(8-chloroquinolin-5-yl)-3-[(3R)-3-(4-methylpiperazin-1-yl)butyl]urea |
|---|---|
| PubChem CID | 125164986 |
| Molecular Formula | C19H26ClN5O |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 1-(8-chloroquinolin-5-yl)-3-[(3R)-3-(4-methylpiperazin-1-yl)butyl]urea |
| SMILES | C[C@H](CCNC(=O)Nc1ccc(Cl)c2ncccc12)N1CCN(C)CC1 |
| InChI | InChI=1S/C19H26ClN5O/c1-14(25-12-10-24(2)11-13-25)7-9-22-19(26)23-17-6-5-16(20)18-15(17)4-3-8-21-18/h3-6,8,14H,7,9-13H2,1-2H3,(H2,22,23,26)/t14-/m1/s1 |
| InChIKey | HSWADGDAEZJFPY-CQSZACIVSA-N |
| XLogP | 3.04 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |