C18H22N4O2 — CID 125166283
N-[(3S)-1-benzoylpiperidin-3-yl]-3,5-dimethylimidazole-4-carboxamide (PubChem CID 125166283) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[(3S)-1-benzoylpiperidin-3-yl]-3,5-dimethylimidazole-4-carboxamide.
| Compound Name | N-[(3S)-1-benzoylpiperidin-3-yl]-3,5-dimethylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 125166283 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-[(3S)-1-benzoylpiperidin-3-yl]-3,5-dimethylimidazole-4-carboxamide |
| SMILES | Cc1ncn(C)c1C(=O)N[C@H]1CCCN(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C18H22N4O2/c1-13-16(21(2)12-19-13)17(23)20-15-9-6-10-22(11-15)18(24)14-7-4-3-5-8-14/h3-5,7-8,12,15H,6,9-11H2,1-2H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | BJEBKKRQGWIPRD-HNNXBMFYSA-N |
| XLogP | 1.76 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |