C10H16N4O4S — CID 12516635
N-(3,5-dinitrothiophen-2-yl)-N',N'-diethylethane-1,2-diamine (PubChem CID 12516635) has the molecular formula C10H16N4O4S and a molecular weight of 288.33 g/mol. Its IUPAC name is N-(3,5-dinitrothiophen-2-yl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(3,5-dinitrothiophen-2-yl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 12516635 |
| Molecular Formula | C10H16N4O4S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-(3,5-dinitrothiophen-2-yl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1sc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H16N4O4S/c1-3-12(4-2)6-5-11-10-8(13(15)16)7-9(19-10)14(17)18/h7,11H,3-6H2,1-2H3 |
| InChIKey | URLLVOBUSGAKNG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|