C15H16F3N3O3 — CID 125168497
(5R)-3-methyl-2-oxo-N-(3,4,5-trifluorophenyl)-1-oxa-3,9-diazaspiro[4.5]decane-9-carboxamide (PubChem CID 125168497) has the molecular formula C15H16F3N3O3 and a molecular weight of 343.31 g/mol. Its IUPAC name is (5R)-3-methyl-2-oxo-N-(3,4,5-trifluorophenyl)-1-oxa-3,9-diazaspiro[4.5]decane-9-carboxamide.
| Compound Name | (5R)-3-methyl-2-oxo-N-(3,4,5-trifluorophenyl)-1-oxa-3,9-diazaspiro[4.5]decane-9-carboxamide |
|---|---|
| PubChem CID | 125168497 |
| Molecular Formula | C15H16F3N3O3 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (5R)-3-methyl-2-oxo-N-(3,4,5-trifluorophenyl)-1-oxa-3,9-diazaspiro[4.5]decane-9-carboxamide |
| SMILES | CN1C[C@]2(CCCN(C(=O)Nc3cc(F)c(F)c(F)c3)C2)OC1=O |
| InChI | InChI=1S/C15H16F3N3O3/c1-20-7-15(24-14(20)23)3-2-4-21(8-15)13(22)19-9-5-10(16)12(18)11(17)6-9/h5-6H,2-4,7-8H2,1H3,(H,19,22)/t15-/m0/s1 |
| InChIKey | LDFJNHNVYGEDJU-HNNXBMFYSA-N |
| XLogP | 2.55 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|