C19H28N4O3 — CID 125168534
N-methyl-N-[3-[(2S)-oxolan-2-yl]propyl]-3-(piperidine-1-carbonyl)pyrazine-2-carboxamide (PubChem CID 125168534) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-methyl-N-[3-[(2S)-oxolan-2-yl]propyl]-3-(piperidine-1-carbonyl)pyrazine-2-carboxamide.
| Compound Name | N-methyl-N-[3-[(2S)-oxolan-2-yl]propyl]-3-(piperidine-1-carbonyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 125168534 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | N-methyl-N-[3-[(2S)-oxolan-2-yl]propyl]-3-(piperidine-1-carbonyl)pyrazine-2-carboxamide |
| SMILES | CN(CCC[C@H]1CCCO1)C(=O)c1nccnc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C19H28N4O3/c1-22(11-5-7-15-8-6-14-26-15)18(24)16-17(21-10-9-20-16)19(25)23-12-3-2-4-13-23/h9-10,15H,2-8,11-14H2,1H3/t15-/m0/s1 |
| InChIKey | CPTKTFWKLUFEOB-HNNXBMFYSA-N |
| XLogP | 2.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |