C15H23N5O — CID 125169618
(2R)-N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-N-methyl-2-pyrazol-1-ylbutanamide (PubChem CID 125169618) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is (2R)-N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-N-methyl-2-pyrazol-1-ylbutanamide.
| Compound Name | (2R)-N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-N-methyl-2-pyrazol-1-ylbutanamide |
|---|---|
| PubChem CID | 125169618 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | (2R)-N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-N-methyl-2-pyrazol-1-ylbutanamide |
| SMILES | CC[C@H](C(=O)N(C)Cc1cnn(CC)c1C)n1cccn1 |
| InChI | InChI=1S/C15H23N5O/c1-5-14(20-9-7-8-16-20)15(21)18(4)11-13-10-17-19(6-2)12(13)3/h7-10,14H,5-6,11H2,1-4H3/t14-/m1/s1 |
| InChIKey | MUZMALMQFNGNLF-CQSZACIVSA-N |
| XLogP | 2.02 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |