About N-[[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine
N-[[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine (PubChem CID 125171154) has the molecular formula C18H24N2O2S
and a molecular weight of 332.47 g/mol. Its IUPAC name is N-[[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine.
Molecular Properties
| Compound Name | N-[[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine |
| PubChem CID | 125171154 |
| Molecular Formula | C18H24N2O2S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-[[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine |
| SMILES | Cc1ncsc1CCOc1cccc(CNC[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C18H24N2O2S/c1-14-18(23-13-20-14)7-9-22-16-5-2-4-15(10-16)11-19-12-17-6-3-8-21-17/h2,4-5,10,13,17,19H,3,6-9,11-12H2,1H3/t17-/m1/s1 |
| InChIKey | LOURKZVDHSOFQN-QGZVFWFLSA-N |
| XLogP | 3.34 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine?
The IUPAC name of N-[[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine (CID 125171154) is N-[[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine.
What is the SMILES notation for N-[[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine?
The canonical SMILES for N-[[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine is Cc1ncsc1CCOc1cccc(CNC[C@H]2CCCO2)c1.
What is the InChIKey of N-[[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine?
The InChIKey is LOURKZVDHSOFQN-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H24N2O2S/c1-14-18(23-13-20-14)7-9-22-16-5-2-4-15(10-16)11-19-12-17-6-3-8-21-17/h2,4-5,10,13,17,19H,3,6-9,11-12H2,1H3/t17-/m1/s1.
What are the key properties of N-[[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine?
N-[[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine has a molecular weight of 332.47 g/mol, XLogP of 3.34, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-[2-(4-methyl-1,3-thiazol-5-yl)ethoxy]phenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine is sourced from PubChem (CID 125171154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).