About N-benzyl-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide
N-benzyl-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide (PubChem CID 1251717) has the molecular formula C19H21N3O4S
and a molecular weight of 387.46 g/mol. Its IUPAC name is N-benzyl-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide.
Molecular Properties
| Compound Name | N-benzyl-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide |
| PubChem CID | 1251717 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-benzyl-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide |
| SMILES | CCn1c(=O)c2cc(S(=O)(=O)NCc3ccccc3)ccc2n(CC)c1=O |
| InChI | InChI=1S/C19H21N3O4S/c1-3-21-17-11-10-15(12-16(17)18(23)22(4-2)19(21)24)27(25,26)20-13-14-8-6-5-7-9-14/h5-12,20H,3-4,13H2,1-2H3 |
| InChIKey | SUAAMXKHGTWDOC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-benzyl-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide?
The IUPAC name of N-benzyl-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide (CID 1251717) is N-benzyl-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide.
What is the SMILES notation for N-benzyl-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide?
The canonical SMILES for N-benzyl-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide is CCn1c(=O)c2cc(S(=O)(=O)NCc3ccccc3)ccc2n(CC)c1=O.
What is the InChIKey of N-benzyl-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide?
The InChIKey is SUAAMXKHGTWDOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O4S/c1-3-21-17-11-10-15(12-16(17)18(23)22(4-2)19(21)24)27(25,26)20-13-14-8-6-5-7-9-14/h5-12,20H,3-4,13H2,1-2H3.
What are the key properties of N-benzyl-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide?
N-benzyl-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide has a molecular weight of 387.46 g/mol, XLogP of 1.68, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1,3-diethyl-2,4-dioxoquinazoline-6-sulfonamide is sourced from PubChem (CID 1251717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).