C21H24FN3O3 — CID 125172176
(2R)-N-[4-fluoro-3-(methylcarbamoyl)phenyl]-2-(3-methoxyphenyl)piperidine-1-carboxamide (PubChem CID 125172176) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is (2R)-N-[4-fluoro-3-(methylcarbamoyl)phenyl]-2-(3-methoxyphenyl)piperidine-1-carboxamide.
| Compound Name | (2R)-N-[4-fluoro-3-(methylcarbamoyl)phenyl]-2-(3-methoxyphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 125172176 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (2R)-N-[4-fluoro-3-(methylcarbamoyl)phenyl]-2-(3-methoxyphenyl)piperidine-1-carboxamide |
| SMILES | CNC(=O)c1cc(NC(=O)N2CCCC[C@@H]2c2cccc(OC)c2)ccc1F |
| InChI | InChI=1S/C21H24FN3O3/c1-23-20(26)17-13-15(9-10-18(17)22)24-21(27)25-11-4-3-8-19(25)14-6-5-7-16(12-14)28-2/h5-7,9-10,12-13,19H,3-4,8,11H2,1-2H3,(H,23,26)(H,24,27)/t19-/m1/s1 |
| InChIKey | QPWHOAOHZICHEU-LJQANCHMSA-N |
| XLogP | 3.95 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |