About N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-amine
N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-amine (PubChem CID 125172812) has the molecular formula C15H21N5O
and a molecular weight of 287.37 g/mol. Its IUPAC name is N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-amine |
| PubChem CID | 125172812 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-amine |
| SMILES | Cc1n[nH]c(C)c1CN(C)c1cc([C@H]2CCOC2)ncn1 |
| InChI | InChI=1S/C15H21N5O/c1-10-13(11(2)19-18-10)7-20(3)15-6-14(16-9-17-15)12-4-5-21-8-12/h6,9,12H,4-5,7-8H2,1-3H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | YIFJEYLWVWPNMR-LBPRGKRZSA-N |
| XLogP | 1.96 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-amine?
The IUPAC name of N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-amine (CID 125172812) is N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-amine.
What is the SMILES notation for N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-amine?
The canonical SMILES for N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-amine is Cc1n[nH]c(C)c1CN(C)c1cc([C@H]2CCOC2)ncn1.
What is the InChIKey of N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-amine?
The InChIKey is YIFJEYLWVWPNMR-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H21N5O/c1-10-13(11(2)19-18-10)7-20(3)15-6-14(16-9-17-15)12-4-5-21-8-12/h6,9,12H,4-5,7-8H2,1-3H3,(H,18,19)/t12-/m0/s1.
What are the key properties of N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-amine?
N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-amine has a molecular weight of 287.37 g/mol, XLogP of 1.96, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N-methyl-6-[(3R)-oxolan-3-yl]pyrimidin-4-amine is sourced from PubChem (CID 125172812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).