C20H26N2O3 — CID 125173686
(4S)-4-(4-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-1-(4-propan-2-yloxyphenyl)pyrrolidin-2-one (PubChem CID 125173686) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is (4S)-4-(4-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-1-(4-propan-2-yloxyphenyl)pyrrolidin-2-one.
| Compound Name | (4S)-4-(4-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-1-(4-propan-2-yloxyphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 125173686 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (4S)-4-(4-methyl-3,6-dihydro-2H-pyridine-1-carbonyl)-1-(4-propan-2-yloxyphenyl)pyrrolidin-2-one |
| SMILES | CC1=CCN(C(=O)[C@H]2CC(=O)N(c3ccc(OC(C)C)cc3)C2)CC1 |
| InChI | InChI=1S/C20H26N2O3/c1-14(2)25-18-6-4-17(5-7-18)22-13-16(12-19(22)23)20(24)21-10-8-15(3)9-11-21/h4-8,14,16H,9-13H2,1-3H3/t16-/m0/s1 |
| InChIKey | CCBSPZIZFYOODH-INIZCTEOSA-N |
| XLogP | 3.01 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|