About hexyl benzenesulfonate
hexyl benzenesulfonate (PubChem CID 12517369) has the molecular formula C12H18O3S
and a molecular weight of 242.34 g/mol. Its IUPAC name is hexyl benzenesulfonate.
Molecular Properties
| Compound Name | hexyl benzenesulfonate |
| PubChem CID | 12517369 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | hexyl benzenesulfonate |
| SMILES | CCCCCCOS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H18O3S/c1-2-3-4-8-11-15-16(13,14)12-9-6-5-7-10-12/h5-7,9-10H,2-4,8,11H2,1H3 |
| InChIKey | KTUVYMAZYSSBKC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze hexyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl benzenesulfonate?
The IUPAC name of hexyl benzenesulfonate (CID 12517369) is hexyl benzenesulfonate.
What is the SMILES notation for hexyl benzenesulfonate?
The canonical SMILES for hexyl benzenesulfonate is CCCCCCOS(=O)(=O)c1ccccc1.
What is the InChIKey of hexyl benzenesulfonate?
The InChIKey is KTUVYMAZYSSBKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3S/c1-2-3-4-8-11-15-16(13,14)12-9-6-5-7-10-12/h5-7,9-10H,2-4,8,11H2,1H3.
What are the key properties of hexyl benzenesulfonate?
hexyl benzenesulfonate has a molecular weight of 242.34 g/mol, XLogP of 2.97, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl benzenesulfonate is sourced from PubChem (CID 12517369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).