About (2S)-2-acetamido-N-[2-(1,3-benzoxazol-2-yl)ethyl]pentanamide
(2S)-2-acetamido-N-[2-(1,3-benzoxazol-2-yl)ethyl]pentanamide (PubChem CID 125174241) has the molecular formula C16H21N3O3
and a molecular weight of 303.36 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[2-(1,3-benzoxazol-2-yl)ethyl]pentanamide.
Molecular Properties
| Compound Name | (2S)-2-acetamido-N-[2-(1,3-benzoxazol-2-yl)ethyl]pentanamide |
| PubChem CID | 125174241 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (2S)-2-acetamido-N-[2-(1,3-benzoxazol-2-yl)ethyl]pentanamide |
| SMILES | CCC[C@H](NC(C)=O)C(=O)NCCc1nc2ccccc2o1 |
| InChI | InChI=1S/C16H21N3O3/c1-3-6-13(18-11(2)20)16(21)17-10-9-15-19-12-7-4-5-8-14(12)22-15/h4-5,7-8,13H,3,6,9-10H2,1-2H3,(H,17,21)(H,18,20)/t13-/m0/s1 |
| InChIKey | DCWKQZLOUPRZSZ-ZDUSSCGKSA-N |
| XLogP | 1.79 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-acetamido-N-[2-(1,3-benzoxazol-2-yl)ethyl]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-acetamido-N-[2-(1,3-benzoxazol-2-yl)ethyl]pentanamide?
The IUPAC name of (2S)-2-acetamido-N-[2-(1,3-benzoxazol-2-yl)ethyl]pentanamide (CID 125174241) is (2S)-2-acetamido-N-[2-(1,3-benzoxazol-2-yl)ethyl]pentanamide.
What is the SMILES notation for (2S)-2-acetamido-N-[2-(1,3-benzoxazol-2-yl)ethyl]pentanamide?
The canonical SMILES for (2S)-2-acetamido-N-[2-(1,3-benzoxazol-2-yl)ethyl]pentanamide is CCC[C@H](NC(C)=O)C(=O)NCCc1nc2ccccc2o1.
What is the InChIKey of (2S)-2-acetamido-N-[2-(1,3-benzoxazol-2-yl)ethyl]pentanamide?
The InChIKey is DCWKQZLOUPRZSZ-ZDUSSCGKSA-N. The full InChI is InChI=1S/C16H21N3O3/c1-3-6-13(18-11(2)20)16(21)17-10-9-15-19-12-7-4-5-8-14(12)22-15/h4-5,7-8,13H,3,6,9-10H2,1-2H3,(H,17,21)(H,18,20)/t13-/m0/s1.
What are the key properties of (2S)-2-acetamido-N-[2-(1,3-benzoxazol-2-yl)ethyl]pentanamide?
(2S)-2-acetamido-N-[2-(1,3-benzoxazol-2-yl)ethyl]pentanamide has a molecular weight of 303.36 g/mol, XLogP of 1.79, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-acetamido-N-[2-(1,3-benzoxazol-2-yl)ethyl]pentanamide is sourced from PubChem (CID 125174241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).