C20H33N5O2 — CID 125174632
(2R)-2-butyl-N-(2-cyclohexyl-5-methylpyrazol-3-yl)-4-methyl-3-oxopiperazine-1-carboxamide (PubChem CID 125174632) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is (2R)-2-butyl-N-(2-cyclohexyl-5-methylpyrazol-3-yl)-4-methyl-3-oxopiperazine-1-carboxamide.
| Compound Name | (2R)-2-butyl-N-(2-cyclohexyl-5-methylpyrazol-3-yl)-4-methyl-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 125174632 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | (2R)-2-butyl-N-(2-cyclohexyl-5-methylpyrazol-3-yl)-4-methyl-3-oxopiperazine-1-carboxamide |
| SMILES | CCCC[C@@H]1C(=O)N(C)CCN1C(=O)Nc1cc(C)nn1C1CCCCC1 |
| InChI | InChI=1S/C20H33N5O2/c1-4-5-11-17-19(26)23(3)12-13-24(17)20(27)21-18-14-15(2)22-25(18)16-9-7-6-8-10-16/h14,16-17H,4-13H2,1-3H3,(H,21,27)/t17-/m1/s1 |
| InChIKey | FVLLGSPSKZCJME-QGZVFWFLSA-N |
| XLogP | 3.56 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |