C20H28N4O — CID 125175137
(2R)-N-(3-methylphenyl)-2-[4-(2-pyrazol-1-ylethyl)piperidin-1-yl]propanamide (PubChem CID 125175137) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is (2R)-N-(3-methylphenyl)-2-[4-(2-pyrazol-1-ylethyl)piperidin-1-yl]propanamide.
| Compound Name | (2R)-N-(3-methylphenyl)-2-[4-(2-pyrazol-1-ylethyl)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 125175137 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | (2R)-N-(3-methylphenyl)-2-[4-(2-pyrazol-1-ylethyl)piperidin-1-yl]propanamide |
| SMILES | Cc1cccc(NC(=O)[C@@H](C)N2CCC(CCn3cccn3)CC2)c1 |
| InChI | InChI=1S/C20H28N4O/c1-16-5-3-6-19(15-16)22-20(25)17(2)23-12-7-18(8-13-23)9-14-24-11-4-10-21-24/h3-6,10-11,15,17-18H,7-9,12-14H2,1-2H3,(H,22,25)/t17-/m1/s1 |
| InChIKey | IABLQYQTRRLLPN-QGZVFWFLSA-N |
| XLogP | 3.32 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |