About 4-chloro-N-[[(2S)-1,4-dioxan-2-yl]methyl]-1,3-dimethylpyrazole-5-carboxamide
4-chloro-N-[[(2S)-1,4-dioxan-2-yl]methyl]-1,3-dimethylpyrazole-5-carboxamide (PubChem CID 125175890) has the molecular formula C11H16ClN3O3
and a molecular weight of 273.72 g/mol. Its IUPAC name is 4-chloro-N-[[(2S)-1,4-dioxan-2-yl]methyl]-1,3-dimethylpyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-N-[[(2S)-1,4-dioxan-2-yl]methyl]-1,3-dimethylpyrazole-5-carboxamide |
| PubChem CID | 125175890 |
| Molecular Formula | C11H16ClN3O3 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 4-chloro-N-[[(2S)-1,4-dioxan-2-yl]methyl]-1,3-dimethylpyrazole-5-carboxamide |
| SMILES | Cc1nn(C)c(C(=O)NC[C@H]2COCCO2)c1Cl |
| InChI | InChI=1S/C11H16ClN3O3/c1-7-9(12)10(15(2)14-7)11(16)13-5-8-6-17-3-4-18-8/h8H,3-6H2,1-2H3,(H,13,16)/t8-/m0/s1 |
| InChIKey | LNOGPNIPFUNPQH-QMMMGPOBSA-N |
| XLogP | 0.53 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-N-[[(2S)-1,4-dioxan-2-yl]methyl]-1,3-dimethylpyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-[[(2S)-1,4-dioxan-2-yl]methyl]-1,3-dimethylpyrazole-5-carboxamide?
The IUPAC name of 4-chloro-N-[[(2S)-1,4-dioxan-2-yl]methyl]-1,3-dimethylpyrazole-5-carboxamide (CID 125175890) is 4-chloro-N-[[(2S)-1,4-dioxan-2-yl]methyl]-1,3-dimethylpyrazole-5-carboxamide.
What is the SMILES notation for 4-chloro-N-[[(2S)-1,4-dioxan-2-yl]methyl]-1,3-dimethylpyrazole-5-carboxamide?
The canonical SMILES for 4-chloro-N-[[(2S)-1,4-dioxan-2-yl]methyl]-1,3-dimethylpyrazole-5-carboxamide is Cc1nn(C)c(C(=O)NC[C@H]2COCCO2)c1Cl.
What is the InChIKey of 4-chloro-N-[[(2S)-1,4-dioxan-2-yl]methyl]-1,3-dimethylpyrazole-5-carboxamide?
The InChIKey is LNOGPNIPFUNPQH-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H16ClN3O3/c1-7-9(12)10(15(2)14-7)11(16)13-5-8-6-17-3-4-18-8/h8H,3-6H2,1-2H3,(H,13,16)/t8-/m0/s1.
What are the key properties of 4-chloro-N-[[(2S)-1,4-dioxan-2-yl]methyl]-1,3-dimethylpyrazole-5-carboxamide?
4-chloro-N-[[(2S)-1,4-dioxan-2-yl]methyl]-1,3-dimethylpyrazole-5-carboxamide has a molecular weight of 273.72 g/mol, XLogP of 0.53, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-[[(2S)-1,4-dioxan-2-yl]methyl]-1,3-dimethylpyrazole-5-carboxamide is sourced from PubChem (CID 125175890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).