C14H9Cl2FS — CID 12517608
3,5-dichloro-1-fluoro-5,6-dihydrobenzo[b][1]benzothiepine (PubChem CID 12517608) has the molecular formula C14H9Cl2FS and a molecular weight of 299.20 g/mol. Its IUPAC name is 3,5-dichloro-1-fluoro-5,6-dihydrobenzo[b][1]benzothiepine.
| Compound Name | 3,5-dichloro-1-fluoro-5,6-dihydrobenzo[b][1]benzothiepine |
|---|---|
| PubChem CID | 12517608 |
| Molecular Formula | C14H9Cl2FS |
| Molecular Weight | 299.20 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 3,5-dichloro-1-fluoro-5,6-dihydrobenzo[b][1]benzothiepine |
| SMILES | Fc1cc(Cl)cc2c1Sc1ccccc1CC2Cl |
| InChI | InChI=1S/C14H9Cl2FS/c15-9-6-10-11(16)5-8-3-1-2-4-13(8)18-14(10)12(17)7-9/h1-4,6-7,11H,5H2 |
| InChIKey | RELAOGPEXFONAK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.20 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|