C15H20N4O3S — CID 125176118
(4S)-N-methyl-2,7-dioxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1,3-diazepane-4-carboxamide (PubChem CID 125176118) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is (4S)-N-methyl-2,7-dioxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1,3-diazepane-4-carboxamide.
| Compound Name | (4S)-N-methyl-2,7-dioxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1,3-diazepane-4-carboxamide |
|---|---|
| PubChem CID | 125176118 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (4S)-N-methyl-2,7-dioxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethyl)-1,3-diazepane-4-carboxamide |
| SMILES | CN(Cc1nc2c(s1)CCCC2)C(=O)[C@@H]1CCC(=O)NC(=O)N1 |
| InChI | InChI=1S/C15H20N4O3S/c1-19(8-13-16-9-4-2-3-5-11(9)23-13)14(21)10-6-7-12(20)18-15(22)17-10/h10H,2-8H2,1H3,(H2,17,18,20,22)/t10-/m0/s1 |
| InChIKey | OMHYXHAFLSRFSO-JTQLQIEISA-N |
| XLogP | 0.97 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |