C16H18N2O4 — CID 125176289
(2S)-N-(2-quinolin-8-yloxyethyl)-1,4-dioxane-2-carboxamide (PubChem CID 125176289) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2S)-N-(2-quinolin-8-yloxyethyl)-1,4-dioxane-2-carboxamide.
| Compound Name | (2S)-N-(2-quinolin-8-yloxyethyl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 125176289 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (2S)-N-(2-quinolin-8-yloxyethyl)-1,4-dioxane-2-carboxamide |
| SMILES | O=C(NCCOc1cccc2cccnc12)[C@@H]1COCCO1 |
| InChI | InChI=1S/C16H18N2O4/c19-16(14-11-20-9-10-22-14)18-7-8-21-13-5-1-3-12-4-2-6-17-15(12)13/h1-6,14H,7-11H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | OZXKFOAAFMDHFN-AWEZNQCLSA-N |
| XLogP | 1.15 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|