C14H21N3O4S — CID 125176909
(3S)-3-methoxy-N-(2-methyl-5-sulfamoylphenyl)piperidine-1-carboxamide (PubChem CID 125176909) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is (3S)-3-methoxy-N-(2-methyl-5-sulfamoylphenyl)piperidine-1-carboxamide.
| Compound Name | (3S)-3-methoxy-N-(2-methyl-5-sulfamoylphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 125176909 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (3S)-3-methoxy-N-(2-methyl-5-sulfamoylphenyl)piperidine-1-carboxamide |
| SMILES | CO[C@H]1CCCN(C(=O)Nc2cc(S(N)(=O)=O)ccc2C)C1 |
| InChI | InChI=1S/C14H21N3O4S/c1-10-5-6-12(22(15,19)20)8-13(10)16-14(18)17-7-3-4-11(9-17)21-2/h5-6,8,11H,3-4,7,9H2,1-2H3,(H,16,18)(H2,15,19,20)/t11-/m0/s1 |
| InChIKey | OEQPTFLGKXKESQ-NSHDSACASA-N |
| XLogP | 1.29 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |