C16H22N6O2 — CID 125177307
(2S)-N-[3-(2-ethyltetrazol-5-yl)phenyl]-2-(hydroxymethyl)piperidine-1-carboxamide (PubChem CID 125177307) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is (2S)-N-[3-(2-ethyltetrazol-5-yl)phenyl]-2-(hydroxymethyl)piperidine-1-carboxamide.
| Compound Name | (2S)-N-[3-(2-ethyltetrazol-5-yl)phenyl]-2-(hydroxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 125177307 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (2S)-N-[3-(2-ethyltetrazol-5-yl)phenyl]-2-(hydroxymethyl)piperidine-1-carboxamide |
| SMILES | CCn1nnc(-c2cccc(NC(=O)N3CCCC[C@H]3CO)c2)n1 |
| InChI | InChI=1S/C16H22N6O2/c1-2-22-19-15(18-20-22)12-6-5-7-13(10-12)17-16(24)21-9-4-3-8-14(21)11-23/h5-7,10,14,23H,2-4,8-9,11H2,1H3,(H,17,24)/t14-/m0/s1 |
| InChIKey | QEGSPZANGGVXIL-AWEZNQCLSA-N |
| XLogP | 1.74 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |