C15H16F3N3O2 — CID 125177834
(9aR)-2-[2-(2,3,4-trifluorophenyl)acetyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one (PubChem CID 125177834) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is (9aR)-2-[2-(2,3,4-trifluorophenyl)acetyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one.
| Compound Name | (9aR)-2-[2-(2,3,4-trifluorophenyl)acetyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one |
|---|---|
| PubChem CID | 125177834 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (9aR)-2-[2-(2,3,4-trifluorophenyl)acetyl]-3,4,6,7,8,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-9-one |
| SMILES | O=C1NCCN2CCN(C(=O)Cc3ccc(F)c(F)c3F)C[C@H]12 |
| InChI | InChI=1S/C15H16F3N3O2/c16-10-2-1-9(13(17)14(10)18)7-12(22)21-6-5-20-4-3-19-15(23)11(20)8-21/h1-2,11H,3-8H2,(H,19,23)/t11-/m1/s1 |
| InChIKey | SNMSVTLQUVUFAY-LLVKDONJSA-N |
| XLogP | 0.29 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|