About 3-ethyl-2,4-dimethylthiomorpholine
3-ethyl-2,4-dimethylthiomorpholine (PubChem CID 12517922) has the molecular formula C8H17NS
and a molecular weight of 159.30 g/mol. Its IUPAC name is 3-ethyl-2,4-dimethylthiomorpholine.
Molecular Properties
| Compound Name | 3-ethyl-2,4-dimethylthiomorpholine |
| PubChem CID | 12517922 |
| Molecular Formula | C8H17NS |
| Molecular Weight | 159.30 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | 3-ethyl-2,4-dimethylthiomorpholine |
| SMILES | CCC1C(C)SCCN1C |
| InChI | InChI=1S/C8H17NS/c1-4-8-7(2)10-6-5-9(8)3/h7-8H,4-6H2,1-3H3 |
| InChIKey | KBYSXSQMDXYYPC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-2,4-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2,4-dimethylthiomorpholine?
The IUPAC name of 3-ethyl-2,4-dimethylthiomorpholine (CID 12517922) is 3-ethyl-2,4-dimethylthiomorpholine.
What is the SMILES notation for 3-ethyl-2,4-dimethylthiomorpholine?
The canonical SMILES for 3-ethyl-2,4-dimethylthiomorpholine is CCC1C(C)SCCN1C.
What is the InChIKey of 3-ethyl-2,4-dimethylthiomorpholine?
The InChIKey is KBYSXSQMDXYYPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NS/c1-4-8-7(2)10-6-5-9(8)3/h7-8H,4-6H2,1-3H3.
What are the key properties of 3-ethyl-2,4-dimethylthiomorpholine?
3-ethyl-2,4-dimethylthiomorpholine has a molecular weight of 159.30 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2,4-dimethylthiomorpholine is sourced from PubChem (CID 12517922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).