C18H19ClN2OS — CID 125179839
(2R)-N-[(7-chloro-2-thiophen-3-ylquinolin-3-yl)methyl]-1-methoxypropan-2-amine (PubChem CID 125179839) has the molecular formula C18H19ClN2OS and a molecular weight of 346.88 g/mol. Its IUPAC name is (2R)-N-[(7-chloro-2-thiophen-3-ylquinolin-3-yl)methyl]-1-methoxypropan-2-amine.
| Compound Name | (2R)-N-[(7-chloro-2-thiophen-3-ylquinolin-3-yl)methyl]-1-methoxypropan-2-amine |
|---|---|
| PubChem CID | 125179839 |
| Molecular Formula | C18H19ClN2OS |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | (2R)-N-[(7-chloro-2-thiophen-3-ylquinolin-3-yl)methyl]-1-methoxypropan-2-amine |
| SMILES | COC[C@@H](C)NCc1cc2ccc(Cl)cc2nc1-c1ccsc1 |
| InChI | InChI=1S/C18H19ClN2OS/c1-12(10-22-2)20-9-15-7-13-3-4-16(19)8-17(13)21-18(15)14-5-6-23-11-14/h3-8,11-12,20H,9-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | NKOHOTLLBOCZBZ-GFCCVEGCSA-N |
| XLogP | 4.74 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |