About fluorooxy-[(1S)-4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]borinic acid
fluorooxy-[(1S)-4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]borinic acid (PubChem CID 125180200) has the molecular formula C8H8BFO4
and a molecular weight of 197.96 g/mol. Its IUPAC name is fluorooxy-[(1S)-4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]borinic acid.
Molecular Properties
| Compound Name | fluorooxy-[(1S)-4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]borinic acid |
| PubChem CID | 125180200 |
| Molecular Formula | C8H8BFO4 |
| Molecular Weight | 197.96 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | fluorooxy-[(1S)-4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]borinic acid |
| SMILES | COC1=CC(=C=O)[C@@H](B(O)OF)C=C1 |
| InChI | InChI=1S/C8H8BFO4/c1-13-7-2-3-8(9(12)14-10)6(4-7)5-11/h2-4,8,12H,1H3/t8-/m0/s1 |
| InChIKey | WUZOKPKPIYGCLE-QMMMGPOBSA-N |
| XLogP | 0.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.96 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze fluorooxy-[(1S)-4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorooxy-[(1S)-4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]borinic acid?
The IUPAC name of fluorooxy-[(1S)-4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]borinic acid (CID 125180200) is fluorooxy-[(1S)-4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]borinic acid.
What is the SMILES notation for fluorooxy-[(1S)-4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]borinic acid?
The canonical SMILES for fluorooxy-[(1S)-4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]borinic acid is COC1=CC(=C=O)[C@@H](B(O)OF)C=C1.
What is the InChIKey of fluorooxy-[(1S)-4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]borinic acid?
The InChIKey is WUZOKPKPIYGCLE-QMMMGPOBSA-N. The full InChI is InChI=1S/C8H8BFO4/c1-13-7-2-3-8(9(12)14-10)6(4-7)5-11/h2-4,8,12H,1H3/t8-/m0/s1.
What are the key properties of fluorooxy-[(1S)-4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]borinic acid?
fluorooxy-[(1S)-4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]borinic acid has a molecular weight of 197.96 g/mol, XLogP of 0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluorooxy-[(1S)-4-methoxy-6-(oxomethylidene)cyclohexa-2,4-dien-1-yl]borinic acid is sourced from PubChem (CID 125180200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).