C15H16Br2O4 — CID 125180763
(1'S,2'S,6'S,7'S,10'R)-1',4'-dibromo-10'-(1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene] (PubChem CID 125180763) has the molecular formula C15H16Br2O4 and a molecular weight of 420.10 g/mol. Its IUPAC name is (1'S,2'S,6'S,7'S,10'R)-1',4'-dibromo-10'-(1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene].
| Compound Name | (1'S,2'S,6'S,7'S,10'R)-1',4'-dibromo-10'-(1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene] |
|---|---|
| PubChem CID | 125180763 |
| Molecular Formula | C15H16Br2O4 |
| Molecular Weight | 420.10 g/mol |
| Exact Mass | 417.94 |
| IUPAC Name | (1'S,2'S,6'S,7'S,10'R)-1',4'-dibromo-10'-(1,3-dioxolan-2-yl)spiro[1,3-dioxolane-2,5'-tricyclo[5.2.1.02,6]deca-3,8-diene] |
| SMILES | BrC1=C[C@@H]2[C@H]([C@@H]3C=C[C@@]2(Br)[C@H]3C2OCCO2)C12OCCO2 |
| InChI | InChI=1S/C15H16Br2O4/c16-10-7-9-11(15(10)20-5-6-21-15)8-1-2-14(9,17)12(8)13-18-3-4-19-13/h1-2,7-9,11-13H,3-6H2/t8-,9+,11-,12+,14-/m0/s1 |
| InChIKey | UQAUDBBKHNHHEV-JMEFFGAQSA-N |
| XLogP | 2.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.10 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|