About (R)-(1,5-dimethylpyrazol-3-yl)-pyridin-3-ylmethanol
(R)-(1,5-dimethylpyrazol-3-yl)-pyridin-3-ylmethanol (PubChem CID 125180983) has the molecular formula C11H13N3O
and a molecular weight of 203.25 g/mol. Its IUPAC name is (R)-(1,5-dimethylpyrazol-3-yl)-pyridin-3-ylmethanol.
Molecular Properties
| Compound Name | (R)-(1,5-dimethylpyrazol-3-yl)-pyridin-3-ylmethanol |
| PubChem CID | 125180983 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | (R)-(1,5-dimethylpyrazol-3-yl)-pyridin-3-ylmethanol |
| SMILES | Cc1cc([C@H](O)c2cccnc2)nn1C |
| InChI | InChI=1S/C11H13N3O/c1-8-6-10(13-14(8)2)11(15)9-4-3-5-12-7-9/h3-7,11,15H,1-2H3/t11-/m1/s1 |
| InChIKey | LSIPTIMAHGPCHU-LLVKDONJSA-N |
| XLogP | 1.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (R)-(1,5-dimethylpyrazol-3-yl)-pyridin-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-(1,5-dimethylpyrazol-3-yl)-pyridin-3-ylmethanol?
The IUPAC name of (R)-(1,5-dimethylpyrazol-3-yl)-pyridin-3-ylmethanol (CID 125180983) is (R)-(1,5-dimethylpyrazol-3-yl)-pyridin-3-ylmethanol.
What is the SMILES notation for (R)-(1,5-dimethylpyrazol-3-yl)-pyridin-3-ylmethanol?
The canonical SMILES for (R)-(1,5-dimethylpyrazol-3-yl)-pyridin-3-ylmethanol is Cc1cc([C@H](O)c2cccnc2)nn1C.
What is the InChIKey of (R)-(1,5-dimethylpyrazol-3-yl)-pyridin-3-ylmethanol?
The InChIKey is LSIPTIMAHGPCHU-LLVKDONJSA-N. The full InChI is InChI=1S/C11H13N3O/c1-8-6-10(13-14(8)2)11(15)9-4-3-5-12-7-9/h3-7,11,15H,1-2H3/t11-/m1/s1.
What are the key properties of (R)-(1,5-dimethylpyrazol-3-yl)-pyridin-3-ylmethanol?
(R)-(1,5-dimethylpyrazol-3-yl)-pyridin-3-ylmethanol has a molecular weight of 203.25 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-(1,5-dimethylpyrazol-3-yl)-pyridin-3-ylmethanol is sourced from PubChem (CID 125180983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).