About [(3S)-2,2-dimethyloxolan-3-yl]hydrazine
[(3S)-2,2-dimethyloxolan-3-yl]hydrazine (PubChem CID 125181041) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is [(3S)-2,2-dimethyloxolan-3-yl]hydrazine.
Molecular Properties
| Compound Name | [(3S)-2,2-dimethyloxolan-3-yl]hydrazine |
| PubChem CID | 125181041 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | [(3S)-2,2-dimethyloxolan-3-yl]hydrazine |
| SMILES | CC1(C)OCC[C@@H]1NN |
| InChI | InChI=1S/C6H14N2O/c1-6(2)5(8-7)3-4-9-6/h5,8H,3-4,7H2,1-2H3/t5-/m0/s1 |
| InChIKey | QJGFDECMTWZSDL-YFKPBYRVSA-N |
| XLogP | 0.02 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-2,2-dimethyloxolan-3-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-2,2-dimethyloxolan-3-yl]hydrazine?
The IUPAC name of [(3S)-2,2-dimethyloxolan-3-yl]hydrazine (CID 125181041) is [(3S)-2,2-dimethyloxolan-3-yl]hydrazine.
What is the SMILES notation for [(3S)-2,2-dimethyloxolan-3-yl]hydrazine?
The canonical SMILES for [(3S)-2,2-dimethyloxolan-3-yl]hydrazine is CC1(C)OCC[C@@H]1NN.
What is the InChIKey of [(3S)-2,2-dimethyloxolan-3-yl]hydrazine?
The InChIKey is QJGFDECMTWZSDL-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H14N2O/c1-6(2)5(8-7)3-4-9-6/h5,8H,3-4,7H2,1-2H3/t5-/m0/s1.
What are the key properties of [(3S)-2,2-dimethyloxolan-3-yl]hydrazine?
[(3S)-2,2-dimethyloxolan-3-yl]hydrazine has a molecular weight of 130.19 g/mol, XLogP of 0.02, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-2,2-dimethyloxolan-3-yl]hydrazine is sourced from PubChem (CID 125181041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).