C20H26F2N4O2 — CID 125181307
N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-(5-fluoropentyl)-3-(4-fluorophenyl)pyrazole-5-carboxamide (PubChem CID 125181307) has the molecular formula C20H26F2N4O2 and a molecular weight of 392.45 g/mol. Its IUPAC name is N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-(5-fluoropentyl)-3-(4-fluorophenyl)pyrazole-5-carboxamide.
| Compound Name | N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-(5-fluoropentyl)-3-(4-fluorophenyl)pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 125181307 |
| Molecular Formula | C20H26F2N4O2 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | N-[(2S)-1-amino-3-methyl-1-oxobutan-2-yl]-1-(5-fluoropentyl)-3-(4-fluorophenyl)pyrazole-5-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)c1cc(-c2ccc(F)cc2)nn1CCCCCF)C(N)=O |
| InChI | InChI=1S/C20H26F2N4O2/c1-13(2)18(19(23)27)24-20(28)17-12-16(14-6-8-15(22)9-7-14)25-26(17)11-5-3-4-10-21/h6-9,12-13,18H,3-5,10-11H2,1-2H3,(H2,23,27)(H,24,28)/t18-/m0/s1 |
| InChIKey | JPKXVUNTSWGYKJ-SFHVURJKSA-N |
| XLogP | 3.07 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|