C24H39NO9 — CID 125181584
(1S,2R,3S,4R,5R,6R,7S,8R,9S,10S,13S,14S,16R,17S,18R)-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8,14-pentol (PubChem CID 125181584) has the molecular formula C24H39NO9 and a molecular weight of 485.57 g/mol. Its IUPAC name is (1S,2R,3S,4R,5R,6R,7S,8R,9S,10S,13S,14S,16R,17S,18R)-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8,14-pentol.
| Compound Name | (1S,2R,3S,4R,5R,6R,7S,8R,9S,10S,13S,14S,16R,17S,18R)-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8,14-pentol |
|---|---|
| PubChem CID | 125181584 |
| Molecular Formula | C24H39NO9 |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | (1S,2R,3S,4R,5R,6R,7S,8R,9S,10S,13S,14S,16R,17S,18R)-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,5,7,8,14-pentol |
| SMILES | COC[C@@]12CN(C)[C@H]3[C@H]4[C@H](OC)[C@H]1[C@]3([C@@H]1C[C@@]3(O)[C@H](O)[C@H]1[C@]4(O)[C@@H](O)[C@H]3OC)[C@H](OC)C[C@@H]2O |
| InChI | InChI=1S/C24H39NO9/c1-25-8-21(9-31-2)11(26)6-12(32-3)23-10-7-22(29)18(27)13(10)24(30,19(28)20(22)34-5)14(17(23)25)15(33-4)16(21)23/h10-20,26-30H,6-9H2,1-5H3/t10-,11+,12-,13+,14-,15+,16-,17+,18-,19+,20-,21-,22-,23+,24-/m1/s1 |
| InChIKey | GQRPJUIKGLHLLN-WFJOBPSHSA-N |
| XLogP | -2.18 |
| TPSA | 141.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |