C13H24N2 — CID 12518209
(1Z,3E)-N,N-diethyl-1-pyrrolidin-1-ylpenta-1,3-dien-1-amine (PubChem CID 12518209) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (1Z,3E)-N,N-diethyl-1-pyrrolidin-1-ylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3E)-N,N-diethyl-1-pyrrolidin-1-ylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 12518209 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (1Z,3E)-N,N-diethyl-1-pyrrolidin-1-ylpenta-1,3-dien-1-amine |
| SMILES | C/C=C/C=C(/N(CC)CC)N1CCCC1 |
| InChI | InChI=1S/C13H24N2/c1-4-7-10-13(14(5-2)6-3)15-11-8-9-12-15/h4,7,10H,5-6,8-9,11-12H2,1-3H3/b7-4+,13-10- |
| InChIKey | ILVZJUJWFVPNAJ-AHGNYBSDSA-N |
| XLogP | 2.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|