C16H20F2N4O3 — CID 125182420
(3aS,6aS)-N-(3,3-difluorocyclobutyl)-5-(6-methoxypyrimidin-4-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide (PubChem CID 125182420) has the molecular formula C16H20F2N4O3 and a molecular weight of 354.36 g/mol. Its IUPAC name is (3aS,6aS)-N-(3,3-difluorocyclobutyl)-5-(6-methoxypyrimidin-4-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide.
| Compound Name | (3aS,6aS)-N-(3,3-difluorocyclobutyl)-5-(6-methoxypyrimidin-4-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide |
|---|---|
| PubChem CID | 125182420 |
| Molecular Formula | C16H20F2N4O3 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (3aS,6aS)-N-(3,3-difluorocyclobutyl)-5-(6-methoxypyrimidin-4-yl)-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxamide |
| SMILES | COc1cc(N2C[C@H]3COC[C@@]3(C(=O)NC3CC(F)(F)C3)C2)ncn1 |
| InChI | InChI=1S/C16H20F2N4O3/c1-24-13-2-12(19-9-20-13)22-5-10-6-25-8-15(10,7-22)14(23)21-11-3-16(17,18)4-11/h2,9-11H,3-8H2,1H3,(H,21,23)/t10-,15-/m0/s1 |
| InChIKey | IPPQJTLCAUJOKB-BONVTDFDSA-N |
| XLogP | 0.85 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |