About 2-butylsulfinylethanol
2-butylsulfinylethanol (PubChem CID 12518262) has the molecular formula C6H14O2S
and a molecular weight of 150.24 g/mol. Its IUPAC name is 2-butylsulfinylethanol.
Molecular Properties
| Compound Name | 2-butylsulfinylethanol |
| PubChem CID | 12518262 |
| Molecular Formula | C6H14O2S |
| Molecular Weight | 150.24 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 2-butylsulfinylethanol |
| SMILES | CCCCS(=O)CCO |
| InChI | InChI=1S/C6H14O2S/c1-2-3-5-9(8)6-4-7/h7H,2-6H2,1H3 |
| InChIKey | BAMLEZOLLYVQCY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butylsulfinylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butylsulfinylethanol?
The IUPAC name of 2-butylsulfinylethanol (CID 12518262) is 2-butylsulfinylethanol.
What is the SMILES notation for 2-butylsulfinylethanol?
The canonical SMILES for 2-butylsulfinylethanol is CCCCS(=O)CCO.
What is the InChIKey of 2-butylsulfinylethanol?
The InChIKey is BAMLEZOLLYVQCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2S/c1-2-3-5-9(8)6-4-7/h7H,2-6H2,1H3.
What are the key properties of 2-butylsulfinylethanol?
2-butylsulfinylethanol has a molecular weight of 150.24 g/mol, XLogP of 0.53, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butylsulfinylethanol is sourced from PubChem (CID 12518262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).