C18H21FN4O2 — CID 125184262
(4aR,7R,7aR)-4-(5-fluoropyrimidin-2-yl)-7-[(6-methyl-2-pyridinyl)methoxy]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 125184262) has the molecular formula C18H21FN4O2 and a molecular weight of 344.39 g/mol. Its IUPAC name is (4aR,7R,7aR)-4-(5-fluoropyrimidin-2-yl)-7-[(6-methyl-2-pyridinyl)methoxy]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | (4aR,7R,7aR)-4-(5-fluoropyrimidin-2-yl)-7-[(6-methyl-2-pyridinyl)methoxy]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 125184262 |
| Molecular Formula | C18H21FN4O2 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (4aR,7R,7aR)-4-(5-fluoropyrimidin-2-yl)-7-[(6-methyl-2-pyridinyl)methoxy]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | Cc1cccc(CO[C@@H]2CC[C@@H]3[C@H]2OCCN3c2ncc(F)cn2)n1 |
| InChI | InChI=1S/C18H21FN4O2/c1-12-3-2-4-14(22-12)11-25-16-6-5-15-17(16)24-8-7-23(15)18-20-9-13(19)10-21-18/h2-4,9-10,15-17H,5-8,11H2,1H3/t15-,16-,17-/m1/s1 |
| InChIKey | BEVMMHMQOUGUSM-BRWVUGGUSA-N |
| XLogP | 2.27 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |