C15H21FN2O — CID 125185264
(5aR,9aR)-8-(3-fluorophenyl)-4-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine (PubChem CID 125185264) has the molecular formula C15H21FN2O and a molecular weight of 264.34 g/mol. Its IUPAC name is (5aR,9aR)-8-(3-fluorophenyl)-4-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine.
| Compound Name | (5aR,9aR)-8-(3-fluorophenyl)-4-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine |
|---|---|
| PubChem CID | 125185264 |
| Molecular Formula | C15H21FN2O |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | (5aR,9aR)-8-(3-fluorophenyl)-4-methyl-2,3,5,5a,6,7,9,9a-octahydropyrido[4,3-f][1,4]oxazepine |
| SMILES | CN1CCO[C@H]2CN(c3cccc(F)c3)CC[C@@H]2C1 |
| InChI | InChI=1S/C15H21FN2O/c1-17-7-8-19-15-11-18(6-5-12(15)10-17)14-4-2-3-13(16)9-14/h2-4,9,12,15H,5-8,10-11H2,1H3/t12-,15+/m1/s1 |
| InChIKey | URMMTUIQHQPLMI-DOMZBBRYSA-N |
| XLogP | 1.98 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |