About (2S)-N-tert-butyl-2-hydroxy-3,3-dimethylbutanamide
(2S)-N-tert-butyl-2-hydroxy-3,3-dimethylbutanamide (PubChem CID 12518938) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is (2S)-N-tert-butyl-2-hydroxy-3,3-dimethylbutanamide.
Molecular Properties
| Compound Name | (2S)-N-tert-butyl-2-hydroxy-3,3-dimethylbutanamide |
| PubChem CID | 12518938 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | (2S)-N-tert-butyl-2-hydroxy-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)NC(=O)[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C10H21NO2/c1-9(2,3)7(12)8(13)11-10(4,5)6/h7,12H,1-6H3,(H,11,13)/t7-/m1/s1 |
| InChIKey | HVEQNWKEBFQHMJ-SSDOTTSWSA-N |
| XLogP | 1.31 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-N-tert-butyl-2-hydroxy-3,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-tert-butyl-2-hydroxy-3,3-dimethylbutanamide?
The IUPAC name of (2S)-N-tert-butyl-2-hydroxy-3,3-dimethylbutanamide (CID 12518938) is (2S)-N-tert-butyl-2-hydroxy-3,3-dimethylbutanamide.
What is the SMILES notation for (2S)-N-tert-butyl-2-hydroxy-3,3-dimethylbutanamide?
The canonical SMILES for (2S)-N-tert-butyl-2-hydroxy-3,3-dimethylbutanamide is CC(C)(C)NC(=O)[C@@H](O)C(C)(C)C.
What is the InChIKey of (2S)-N-tert-butyl-2-hydroxy-3,3-dimethylbutanamide?
The InChIKey is HVEQNWKEBFQHMJ-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H21NO2/c1-9(2,3)7(12)8(13)11-10(4,5)6/h7,12H,1-6H3,(H,11,13)/t7-/m1/s1.
What are the key properties of (2S)-N-tert-butyl-2-hydroxy-3,3-dimethylbutanamide?
(2S)-N-tert-butyl-2-hydroxy-3,3-dimethylbutanamide has a molecular weight of 187.28 g/mol, XLogP of 1.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-tert-butyl-2-hydroxy-3,3-dimethylbutanamide is sourced from PubChem (CID 12518938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).