About 2-(dichloromethyl)-2,5-dihydrofuran
2-(dichloromethyl)-2,5-dihydrofuran (PubChem CID 12518972) has the molecular formula C5H6Cl2O
and a molecular weight of 153.01 g/mol. Its IUPAC name is 2-(dichloromethyl)-2,5-dihydrofuran.
Molecular Properties
| Compound Name | 2-(dichloromethyl)-2,5-dihydrofuran |
| PubChem CID | 12518972 |
| Molecular Formula | C5H6Cl2O |
| Molecular Weight | 153.01 g/mol |
| Exact Mass | 151.98 |
| IUPAC Name | 2-(dichloromethyl)-2,5-dihydrofuran |
| SMILES | ClC(Cl)C1C=CCO1 |
| InChI | InChI=1S/C5H6Cl2O/c6-5(7)4-2-1-3-8-4/h1-2,4-5H,3H2 |
| InChIKey | ZXVKTXHOKOPYPZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.01 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(dichloromethyl)-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dichloromethyl)-2,5-dihydrofuran?
The IUPAC name of 2-(dichloromethyl)-2,5-dihydrofuran (CID 12518972) is 2-(dichloromethyl)-2,5-dihydrofuran.
What is the SMILES notation for 2-(dichloromethyl)-2,5-dihydrofuran?
The canonical SMILES for 2-(dichloromethyl)-2,5-dihydrofuran is ClC(Cl)C1C=CCO1.
What is the InChIKey of 2-(dichloromethyl)-2,5-dihydrofuran?
The InChIKey is ZXVKTXHOKOPYPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6Cl2O/c6-5(7)4-2-1-3-8-4/h1-2,4-5H,3H2.
What are the key properties of 2-(dichloromethyl)-2,5-dihydrofuran?
2-(dichloromethyl)-2,5-dihydrofuran has a molecular weight of 153.01 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dichloromethyl)-2,5-dihydrofuran is sourced from PubChem (CID 12518972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).