C8H10Cl2O2 — CID 12519115
3,3-dichloro-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one (PubChem CID 12519115) has the molecular formula C8H10Cl2O2 and a molecular weight of 209.07 g/mol. Its IUPAC name is 3,3-dichloro-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one.
| Compound Name | 3,3-dichloro-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 12519115 |
| Molecular Formula | C8H10Cl2O2 |
| Molecular Weight | 209.07 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | 3,3-dichloro-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
| SMILES | O=C1OC2CCCCC2C1(Cl)Cl |
| InChI | InChI=1S/C8H10Cl2O2/c9-8(10)5-3-1-2-4-6(5)12-7(8)11/h5-6H,1-4H2 |
| InChIKey | HZOSGSRPCDQQKW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.07 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|