About 2-(2,3-dihydroindol-1-yl)-5-(trifluoromethyl)aniline;hydrochloride
2-(2,3-dihydroindol-1-yl)-5-(trifluoromethyl)aniline;hydrochloride (PubChem CID 12519123) has the molecular formula C15H14ClF3N2
and a molecular weight of 314.74 g/mol. Its IUPAC name is 2-(2,3-dihydroindol-1-yl)-5-(trifluoromethyl)aniline;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,3-dihydroindol-1-yl)-5-(trifluoromethyl)aniline;hydrochloride |
| PubChem CID | 12519123 |
| Molecular Formula | C15H14ClF3N2 |
| Molecular Weight | 314.74 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 2-(2,3-dihydroindol-1-yl)-5-(trifluoromethyl)aniline;hydrochloride |
| SMILES | Cl.Nc1cc(C(F)(F)F)ccc1N1CCc2ccccc21 |
| InChI | InChI=1S/C15H13F3N2.ClH/c16-15(17,18)11-5-6-14(12(19)9-11)20-8-7-10-3-1-2-4-13(10)20;/h1-6,9H,7-8,19H2;1H |
| InChIKey | JETFFSHQCLNMMA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.74 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dihydroindol-1-yl)-5-(trifluoromethyl)aniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydroindol-1-yl)-5-(trifluoromethyl)aniline;hydrochloride?
The IUPAC name of 2-(2,3-dihydroindol-1-yl)-5-(trifluoromethyl)aniline;hydrochloride (CID 12519123) is 2-(2,3-dihydroindol-1-yl)-5-(trifluoromethyl)aniline;hydrochloride.
What is the SMILES notation for 2-(2,3-dihydroindol-1-yl)-5-(trifluoromethyl)aniline;hydrochloride?
The canonical SMILES for 2-(2,3-dihydroindol-1-yl)-5-(trifluoromethyl)aniline;hydrochloride is Cl.Nc1cc(C(F)(F)F)ccc1N1CCc2ccccc21.
What is the InChIKey of 2-(2,3-dihydroindol-1-yl)-5-(trifluoromethyl)aniline;hydrochloride?
The InChIKey is JETFFSHQCLNMMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F3N2.ClH/c16-15(17,18)11-5-6-14(12(19)9-11)20-8-7-10-3-1-2-4-13(10)20;/h1-6,9H,7-8,19H2;1H.
What are the key properties of 2-(2,3-dihydroindol-1-yl)-5-(trifluoromethyl)aniline;hydrochloride?
2-(2,3-dihydroindol-1-yl)-5-(trifluoromethyl)aniline;hydrochloride has a molecular weight of 314.74 g/mol, XLogP of 4.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydroindol-1-yl)-5-(trifluoromethyl)aniline;hydrochloride is sourced from PubChem (CID 12519123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).