C16H24N4O — CID 125192019
(7R,8aR)-7-(cyclopropylmethoxy)-2-(5-methylpyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 125192019) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is (7R,8aR)-7-(cyclopropylmethoxy)-2-(5-methylpyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (7R,8aR)-7-(cyclopropylmethoxy)-2-(5-methylpyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 125192019 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | (7R,8aR)-7-(cyclopropylmethoxy)-2-(5-methylpyrimidin-2-yl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | Cc1cnc(N2CCN3C[C@H](OCC4CC4)C[C@@H]3C2)nc1 |
| InChI | InChI=1S/C16H24N4O/c1-12-7-17-16(18-8-12)20-5-4-19-10-15(6-14(19)9-20)21-11-13-2-3-13/h7-8,13-15H,2-6,9-11H2,1H3/t14-,15-/m1/s1 |
| InChIKey | CVACXILMKJJZLE-HUUCEWRRSA-N |
| XLogP | 1.47 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |