C14H23N3S — CID 125193287
2-[[(3aS,6aS)-4-(2-methylpropyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-1,3-thiazole (PubChem CID 125193287) has the molecular formula C14H23N3S and a molecular weight of 265.43 g/mol. Its IUPAC name is 2-[[(3aS,6aS)-4-(2-methylpropyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2-[[(3aS,6aS)-4-(2-methylpropyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 125193287 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 2-[[(3aS,6aS)-4-(2-methylpropyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrol-1-yl]methyl]-1,3-thiazole |
| SMILES | CC(C)CN1CC[C@H]2[C@@H]1CCN2Cc1nccs1 |
| InChI | InChI=1S/C14H23N3S/c1-11(2)9-16-6-3-13-12(16)4-7-17(13)10-14-15-5-8-18-14/h5,8,11-13H,3-4,6-7,9-10H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | KLWJCTJXSVBLCV-STQMWFEESA-N |
| XLogP | 2.45 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |