C15H21N5O2 — CID 125193971
(3aS,6R,7aS)-6-(3-methyl-1,2,4-oxadiazol-5-yl)-4-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine (PubChem CID 125193971) has the molecular formula C15H21N5O2 and a molecular weight of 303.37 g/mol. Its IUPAC name is (3aS,6R,7aS)-6-(3-methyl-1,2,4-oxadiazol-5-yl)-4-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine.
| Compound Name | (3aS,6R,7aS)-6-(3-methyl-1,2,4-oxadiazol-5-yl)-4-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine |
|---|---|
| PubChem CID | 125193971 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | (3aS,6R,7aS)-6-(3-methyl-1,2,4-oxadiazol-5-yl)-4-[(1-methylpyrazol-4-yl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine |
| SMILES | Cc1noc([C@@H]2C[C@@H]3OCC[C@@H]3N(Cc3cnn(C)c3)C2)n1 |
| InChI | InChI=1S/C15H21N5O2/c1-10-17-15(22-18-10)12-5-14-13(3-4-21-14)20(9-12)8-11-6-16-19(2)7-11/h6-7,12-14H,3-5,8-9H2,1-2H3/t12-,13+,14+/m1/s1 |
| InChIKey | IPODHJLXPWESLZ-RDBSUJKOSA-N |
| XLogP | 1.26 |
| TPSA | 69.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |