C11H17F3 — CID 12519453
(6E)-9,9,9-trifluoro-2,6-dimethylnona-2,6-diene (PubChem CID 12519453) has the molecular formula C11H17F3 and a molecular weight of 206.25 g/mol. Its IUPAC name is (6E)-9,9,9-trifluoro-2,6-dimethylnona-2,6-diene.
| Compound Name | (6E)-9,9,9-trifluoro-2,6-dimethylnona-2,6-diene |
|---|---|
| PubChem CID | 12519453 |
| Molecular Formula | C11H17F3 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (6E)-9,9,9-trifluoro-2,6-dimethylnona-2,6-diene |
| SMILES | CC(C)=CCC/C(C)=C/CC(F)(F)F |
| InChI | InChI=1S/C11H17F3/c1-9(2)5-4-6-10(3)7-8-11(12,13)14/h5,7H,4,6,8H2,1-3H3/b10-7+ |
| InChIKey | HBJKLGBBTSWGRV-JXMROGBWSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|