C18H18O2 — CID 12519777
(4bR,10bR)-4b,5,6,10b,11,12-hexahydrochrysene-2,8-diol (PubChem CID 12519777) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is (4bR,10bR)-4b,5,6,10b,11,12-hexahydrochrysene-2,8-diol.
| Compound Name | (4bR,10bR)-4b,5,6,10b,11,12-hexahydrochrysene-2,8-diol |
|---|---|
| PubChem CID | 12519777 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | (4bR,10bR)-4b,5,6,10b,11,12-hexahydrochrysene-2,8-diol |
| SMILES | Oc1ccc2c(c1)CC[C@H]1c3ccc(O)cc3CC[C@@H]21 |
| InChI | InChI=1S/C18H18O2/c19-13-3-7-15-11(9-13)1-5-17-16-8-4-14(20)10-12(16)2-6-18(15)17/h3-4,7-10,17-20H,1-2,5-6H2/t17-,18-/m0/s1 |
| InChIKey | WKSBLYZBEPGLTB-ROUUACIJSA-N |
| XLogP | 3.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |