C15H22N4O3 — CID 125200864
2-[(4aS,7aS)-6-(1-methylpyrrole-2-carbonyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N-methylacetamide (PubChem CID 125200864) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-[(4aS,7aS)-6-(1-methylpyrrole-2-carbonyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N-methylacetamide.
| Compound Name | 2-[(4aS,7aS)-6-(1-methylpyrrole-2-carbonyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 125200864 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 2-[(4aS,7aS)-6-(1-methylpyrrole-2-carbonyl)-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-4-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCO[C@H]2CN(C(=O)c3cccn3C)C[C@@H]21 |
| InChI | InChI=1S/C15H22N4O3/c1-16-14(20)10-18-6-7-22-13-9-19(8-12(13)18)15(21)11-4-3-5-17(11)2/h3-5,12-13H,6-10H2,1-2H3,(H,16,20)/t12-,13-/m0/s1 |
| InChIKey | JJUKBTYRCHKQNQ-STQMWFEESA-N |
| XLogP | -0.70 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |